Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2-(5-Hydroxy-1H-Indol-3-Yl)Acetaldehyde |
|---|---|
| Synonyms | 2-(5-Hydroxy-1H-Indol-3-Yl)Ethanal; 1H-Indole-3-Acetaldehyde, 5-Hydroxy-; 5-Hial |
| Molecular Structure |  |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 |
| CAS Registry Number | 1892-21-3 |
| SMILES | C1=C(C=C2C(=C1)[NH]C=C2CC=O)O |
| InChI | 1S/C10H9NO2/c12-4-3-7-6-11-10-2-1-8(13)5-9(7)10/h1-2,4-6,11,13H,3H2 |
| InChIKey | OBFAPCIUSYHFIE-UHFFFAOYSA-N |
| Density | 1.343g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.998°C at 760 mmHg (Cal.) |
| Flash point | 215.065°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(5-Hydroxy-1H-Indol-3-Yl)Acetaldehyde |