Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Ethyl (1R,2R,3S)-2-Acetyl-3-Methylcyclopropanecarboxylate |
|---|---|
| Synonyms | (1R,2R,3S)-ethyl 2-acetyl-3-methylcyclopropanecarboxylate |
| Molecular Structure |  |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 |
| CAS Registry Number | 189628-62-4 |
| SMILES | CCOC(=O)[C@@H]1[C@H]([C@H]1C(=O)C)C |
| InChI | 1S/C9H14O3/c1-4-12-9(11)8-5(2)7(8)6(3)10/h5,7-8H,4H2,1-3H3/t5-,7-,8+/m0/s1 |
| InChIKey | XCNQVEKFJRXTMJ-APQOSEDMSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 221.8±33.0°C at 760 mmHg (Cal.) |
| Flash point | 88.4±25.4°C (Cal.) |
| Refractive index | 1.459 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl (1R,2R,3S)-2-Acetyl-3-Methylcyclopropanecarboxylate |