Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2,2-Diisopropyltricyclo[1.1.1.01,3]Pentane |
|---|---|
| Synonyms | 2,2-diisopropyltricyclo[1.1.1.01,3]pentane; TRICYCLO[1.1.1.01,3]PENTANE,2,2-BIS(1-METHYLETHYL)- (9CI) |
| Molecular Structure | ![CAS#: 189825-07-8， 2,2-Diisopropyltricyclo[1.1.1.0<Sup>1,3</Sup>]Pentane](/moreStructures/189825-07-8.gif) |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 |
| CAS Registry Number | 189825-07-8 |
| SMILES | CC(C)C1(C23C1(C2)C3)C(C)C |
| InChI | 1S/C11H18/c1-7(2)11(8(3)4)9-5-10(9,11)6-9/h7-8H,5-6H2,1-4H3 |
| InChIKey | NWYSBAIFPHBBIO-UHFFFAOYSA-N |
| Density | 0.96g/cm3 (Cal.) |
|---|---|
| Boiling point | 176.527°C at 760 mmHg (Cal.) |
| Flash point | 47.061°C (Cal.) |
| Refractive index | 1.51 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Diisopropyltricyclo[1.1.1.01,3]Pentane |