Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Plumbous dimethylaminomethanedithioate |
|---|---|
| Synonyms | Plumbous Dimethylaminomethanedithioate; Hsdb 2886; Lead, Bis(Dimethyldithiocarbamate |
| Molecular Structure |  |
| Molecular Formula | C6H12N2PbS4 |
| Molecular Weight | 447.61 |
| CAS Registry Number | 19010-66-3 |
| EINECS | 242-748-2 |
| SMILES | CN(C([S-])=S)C.CN(C([S-])=S)C.[Pb++] |
| InChI | 1S/2C3H7NS2.Pb/c2*1-4(2)3(5)6;/h2*1-2H3,(H,5,6);/q;;+2/p-2 |
| InChIKey | QGTHALAWFUFVCU-UHFFFAOYSA-L |
| Boiling point | 129.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 32°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Plumbous dimethylaminomethanedithioate |