Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 2,5-Diacetamidotoluene |
|---|---|
| Synonyms | N-(4-Acetamido-2-Methyl-Phenyl)Acetamide; N-(4-Acetamido-2-Methyl-Phenyl)Ethanamide |
| Molecular Structure |  |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 |
| CAS Registry Number | 19039-27-1 |
| SMILES | C1=C(C(=CC=C1NC(=O)C)NC(=O)C)C |
| InChI | 1S/C11H14N2O2/c1-7-6-10(12-8(2)14)4-5-11(7)13-9(3)15/h4-6H,1-3H3,(H,12,14)(H,13,15) |
| InChIKey | ZYCWUKASEILJBB-UHFFFAOYSA-N |
| Density | 1.2g/cm3 (Cal.) |
|---|---|
| Boiling point | 443.929°C at 760 mmHg (Cal.) |
| Flash point | 191.948°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5-Diacetamidotoluene |