Online Database of Chemicals from Around the World
|
CAS#: 19048-85-2 Product: (4-Chlorophenyl)Methyl 4-Chlorobenzoate No suppilers available for the product. |
| Name | (4-Chlorophenyl)Methyl 4-Chlorobenzoate |
|---|---|
| Synonyms | 4-Chlorobenzoic Acid (4-Chlorophenyl)Methyl Ester; 4-Chlorobenzoic Acid (4-Chlorobenzyl) Ester; Zinc01695974 |
| Molecular Structure |  |
| Molecular Formula | C14H10Cl2O2 |
| Molecular Weight | 281.14 |
| CAS Registry Number | 19048-85-2 |
| SMILES | C1=CC(=CC=C1Cl)COC(=O)C2=CC=C(C=C2)Cl |
| InChI | 1S/C14H10Cl2O2/c15-12-5-1-10(2-6-12)9-18-14(17)11-3-7-13(16)8-4-11/h1-8H,9H2 |
| InChIKey | SVQZZBZDBJHCAL-UHFFFAOYSA-N |
| Density | 1.327g/cm3 (Cal.) |
|---|---|
| Boiling point | 379.075°C at 760 mmHg (Cal.) |
| Flash point | 151.745°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4-Chlorophenyl)Methyl 4-Chlorobenzoate |