Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 6-Oxa-6-Benzo[cd]Pyrene |
|---|---|
| Synonyms | Nsc96927; Naphtho[2,1,8,7-Klmn]Xanthene; 6-Oxa-6-Benzo(Cd)Pyrene |
| Molecular Structure | ![CAS#: 191-37-7， 6-Oxa-6-Benzo[cd]Pyrene](/moreStructures/191-37-7.gif) |
| Molecular Formula | C18H10O |
| Molecular Weight | 242.28 |
| CAS Registry Number | 191-37-7 |
| EINECS | 205-888-5 |
| SMILES | C3=CC1=C2C(=CC=C1)OC5=C4C2=C3C=CC4=CC=C5 |
| InChI | 1S/C18H10O/c1-3-11-7-9-13-10-8-12-4-2-6-15-17(12)18(13)16(11)14(5-1)19-15/h1-10H |
| InChIKey | UZHFDCLFBVPDGM-UHFFFAOYSA-N |
| Density | 1.373g/cm3 (Cal.) |
|---|---|
| Boiling point | 469.671°C at 760 mmHg (Cal.) |
| Flash point | 238.643°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Oxa-6-Benzo[cd]Pyrene |