Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Tyger Scientific Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (609) 434-0144 | |||
|
sales@tygersci.com | |||
| Chemical manufacturer since 1992 | ||||
| Name | 1-Naphthyl Methacrylate |
|---|---|
| Synonyms | 1-Naphthyl methacrylate; α-NAPHTHYLMETHACRYLATE |
| Molecular Structure |  |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.24 |
| CAS Registry Number | 19102-44-4 |
| SMILES | O=C(Oc2cccc1ccccc12)\C(=C)C |
| InChI | 1S/C14H12O2/c1-10(2)14(15)16-13-9-5-7-11-6-3-4-8-12(11)13/h3-9H,1H2,2H3 |
| InChIKey | HVYCQBKSRWZZGX-UHFFFAOYSA-N |
| Density | 1.122g/cm3 (Cal.) |
|---|---|
| Boiling point | 357.392°C at 760 mmHg (Cal.) |
| Flash point | 149.228°C (Cal.) |
| Refractive index | 1.595 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-Naphthyl Methacrylate |