Online Database of Chemicals from Around the World
| ChemScene LLC | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (732) 484-9848 | |||
 |
sales@chemscene.com | |||
| Chemical manufacturer since 2011 | ||||
| Paragos e. K. | Germany | Inquire | ||
|---|---|---|---|---|
|
+49 2330-8079751 | |||
|
sales@paragos.de | |||
| Chemical manufacturer since 2001 | ||||
| Name | Ethyl 3-[2-(Trifluoromethyl)Phenyl]Propanoate |
|---|---|
| Synonyms | 3-(2-Trifluoromethyl-phenyl)-propionic acid ethyl; BENZENEPROPANOIC ACID,2-(TRIFLUOROMETHYL)-, ETHYL ESTER; ethyl 3-[2-(trifluoromethyl)phenyl]propanoate |
| Molecular Structure | ![CAS#: 191155-80-3， Ethyl 3-[2-(Trifluoromethyl)Phenyl]Propanoate](/moreStructures/191155-80-3.gif) |
| Molecular Formula | C12H13F3O2 |
| Molecular Weight | 246.23 |
| CAS Registry Number | 191155-80-3 |
| SMILES | FC(F)(F)c1ccccc1CCC(=O)OCC |
| InChI | 1S/C12H13F3O2/c1-2-17-11(16)8-7-9-5-3-4-6-10(9)12(13,14)15/h3-6H,2,7-8H2,1H3 |
| InChIKey | OWXNROJGHAWLEG-UHFFFAOYSA-N |
| Density | 1.179g/cm3 (Cal.) |
|---|---|
| Boiling point | 250.759°C at 760 mmHg (Cal.) |
| Flash point | 73.06°C (Cal.) |
| Refractive index | 1.453 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 3-[2-(Trifluoromethyl)Phenyl]Propanoate |