Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | (4S)-4-(Acetyloxy)Dihydro-2(3H)-Furanone |
|---|---|
| Synonyms | [(3S)-5-Oxotetrahydrofuran-3-Yl] Acetate; Acetic Acid [(3S)-5-Oxo-3-Tetrahydrofuranyl] Ester; Acetic Acid [(3S)-5-Ketotetrahydrofuran-3-Yl] Ester |
| Molecular Structure |  |
| Molecular Formula | C6H8O4 |
| Molecular Weight | 144.13 |
| CAS Registry Number | 191403-65-3 |
| SMILES | [C@@H]1(CC(OC1)=O)OC(C)=O |
| InChI | 1S/C6H8O4/c1-4(7)10-5-2-6(8)9-3-5/h5H,2-3H2,1H3/t5-/m0/s1 |
| InChIKey | QOAAHMCFVNHTBI-YFKPBYRVSA-N |
| Density | 1.233g/cm3 (Cal.) |
|---|---|
| Boiling point | 266.089°C at 760 mmHg (Cal.) |
| Flash point | 138.468°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4S)-4-(Acetyloxy)Dihydro-2(3H)-Furanone |