Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 6,7-Dimethyl-2-Pteridinamine |
|---|---|
| Synonyms | 6,7-Dimethyl-2-Pteridinamine; (6,7-Dimethylpteridin-2-Yl)Amine; Zinc00489576 |
| Molecular Structure |  |
| Molecular Formula | C8H9N5 |
| Molecular Weight | 175.19 |
| CAS Registry Number | 19153-00-5 |
| SMILES | C1=NC(=NC2=NC(=C(N=C12)C)C)N |
| InChI | 1S/C8H9N5/c1-4-5(2)12-7-6(11-4)3-10-8(9)13-7/h3H,1-2H3,(H2,9,10,12,13) |
| InChIKey | QDEJQTTZZROSHU-UHFFFAOYSA-N |
| Density | 1.335g/cm3 (Cal.) |
|---|---|
| Boiling point | 388.905°C at 760 mmHg (Cal.) |
| Flash point | 217.389°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,7-Dimethyl-2-Pteridinamine |