|
CAS#: 19163-92-9 Product: Bis(2-Hydroxyethyl)Dithiocarbamic Acid Zinc Salt No suppilers available for the product. |
| Name | Bis(2-Hydroxyethyl)Dithiocarbamic Acid Zinc Salt |
|---|---|
| Synonyms | Bis(Bis(2-Hydroxyethyl)Dithiocarbamato-S,S')Zinc |
| Molecular Structure | ![]() |
| Molecular Formula | C10H20N2O4S4Zn |
| Molecular Weight | 425.90 |
| CAS Registry Number | 19163-92-9 |
| EINECS | 242-852-8 |
| SMILES | C(N(C(=S)[S-])CCO)CO.C(N(C(=S)[S-])CCO)CO.[Zn++] |
| InChI | 1S/2C5H11NO2S2.Zn/c2*7-3-1-6(2-4-8)5(9)10;/h2*7-8H,1-4H2,(H,9,10);/q;;+2/p-2 |
| InChIKey | BRJVMKALQCUXPN-UHFFFAOYSA-L |
| Melting point | 151°C (Expl.) |
|---|---|
| Boiling point | 321°C at 760 mmHg (Cal.) |
| Flash point | 148°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Bis(2-Hydroxyethyl)Dithiocarbamic Acid Zinc Salt |