Online Database of Chemicals from Around the World
| Carbosynth China Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (512) 6260-5585 | |||
 |
sales@carbosynth.com | |||
 |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2016 | ||||
| Name | 2-Deoxy-L-Fucose |
|---|---|
| Synonyms | 2,6-Dideoxy-L-Lyxo-Hexose; 2-Deoxy-L-Fucose; L-Lyxo-Hexose, 2,6-Dideoxy- |
| Molecular Structure |  |
| Molecular Formula | C6H12O4 |
| Molecular Weight | 148.16 |
| CAS Registry Number | 19165-06-1 |
| SMILES | [C@@H](CC=O)(O)[C@H](O)[C@@H](O)C |
| InChI | 1S/C6H12O4/c1-4(8)6(10)5(9)2-3-7/h3-6,8-10H,2H2,1H3/t4-,5-,6+/m0/s1 |
| InChIKey | JWFRNGYBHLBCMB-HCWXCVPCSA-N |
| Density | 1.25g/cm3 (Cal.) |
|---|---|
| Boiling point | 365.9°C at 760 mmHg (Cal.) |
| Flash point | 189.274°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Deoxy-L-Fucose |