| CAS: 19170-96-8 Product: 1,1,1,2,3,3,3-Heptadeuterio-2-(trideuteriomethyl)propane No suppliers available. |
| Name | 1,1,1,2,3,3,3-Heptadeuterio-2-(trideuteriomethyl)propane |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C4D10 |
| Molecular Weight | 68.18 |
| CAS Registry Number | 19170-96-8 |
| EC Number | 694-167-2 |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| Solubility | 175.1 mg/L (25 °C water) |
|---|---|
| Density | 0.6±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.352, Calc.* |
| Melting point | -132.55 °C |
| Boiling Point | 3.21 °C, -10.5±3.0 °C (760 mmHg), Calc.* |
| Flash Point | -71.5±10.3 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H220-H280 Details | ||||||||||||
| Safety Statements | P410+P403 Details | ||||||||||||
| Hazard Classification | |||||||||||||
| |||||||||||||
| SDS | Available | ||||||||||||
| Market Analysis Reports |
| List of Reports Available for 1,1,1,2,3,3,3-Heptadeuterio-2-(trideuteriomethyl)propane |