Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1-(2,6-Dimethylphenyl)-Azetidine |
|---|---|
| Synonyms | N-(2,6-Dimethylphenyl)Azetidine |
| Molecular Structure |  |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 |
| CAS Registry Number | 19199-06-5 |
| SMILES | C1=C(C(=C(C=C1)C)N2CCC2)C |
| InChI | 1S/C11H15N/c1-9-5-3-6-10(2)11(9)12-7-4-8-12/h3,5-6H,4,7-8H2,1-2H3 |
| InChIKey | MHXYJRDWCLHKMY-UHFFFAOYSA-N |
| Density | 1.016g/cm3 (Cal.) |
|---|---|
| Boiling point | 250.885°C at 760 mmHg (Cal.) |
| Flash point | 96.428°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2,6-Dimethylphenyl)-Azetidine |