Online Database of Chemicals from Around the World
| Name | 5-Oxa-5H-Dibenzo(c,mn)Phenanthrene |
|---|---|
| Synonyms | Ceroxene; Naphtho(3,2,1-Kl)Xanthene |
| Molecular Structure |  |
| Molecular Formula | C20H12O |
| Molecular Weight | 268.31 |
| CAS Registry Number | 192-16-5 |
| SMILES | C3=C5C(=C1C4=C(OC2=C1C=CC=C2)C=CC=C34)C=CC=C5 |
| InChI | 1S/C20H12O/c1-2-8-15-13(6-1)12-14-7-5-11-18-19(14)20(15)16-9-3-4-10-17(16)21-18/h1-12H |
| InChIKey | HJQJWSOIRGXSES-UHFFFAOYSA-N |
| Density | 1.292g/cm3 (Cal.) |
|---|---|
| Boiling point | 487.868°C at 760 mmHg (Cal.) |
| Flash point | 250.237°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 5-Oxa-5H-Dibenzo(c,mn)Phenanthrene |
