| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1,2:6,7-Dibenzpyrene (Van) |
|---|---|
| Synonyms | Dibenzo(Fg,Op)Naphthacene; Dibenzo(E,L)Pyrene; Dibenzo(Fg,Op)Naphthacene (8Ci)(9Ci) |
| Molecular Structure | ![]() |
| Molecular Formula | C24H14 |
| Molecular Weight | 302.37 |
| CAS Registry Number | 192-51-8 |
| SMILES | C2=C5C1=C4C(=C3C(=C1C=C2)C=CC=C3)C=CC=C4C6=C5C=CC=C6 |
| InChI | 1S/C24H14/c1-2-8-16-15(7-1)19-11-5-13-21-17-9-3-4-10-18(17)22-14-6-12-20(16)24(22)23(19)21/h1-14H |
| InChIKey | BMIAHKYKCHRGBA-UHFFFAOYSA-N |
| Density | 1.313g/cm3 (Cal.) |
|---|---|
| Boiling point | 552.265°C at 760 mmHg (Cal.) |
| Flash point | 281.957°C (Cal.) |
| (1) | Sandeep Kumar, Jaishri J. Naidu and D. S. Shankar Rao. Novel dibenzo[fg,op]naphthacene discotic liquid crystals: a versatile rational synthesis, J. Mater. Chem., 2002, 12, 1335. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,2:6,7-Dibenzpyrene (Van) |