Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 5-Nitro-1H-Pyrrol-2-Amine |
|---|---|
| Synonyms | 1H-Pyrrol-2-amine,5-nitro- |
| Molecular Structure |  |
| Molecular Formula | C4H5N3O2 |
| Molecular Weight | 127.10 |
| CAS Registry Number | 192003-26-2 |
| SMILES | c1cc([nH]c1N)[N+](=O)[O-] |
| InChI | 1S/C4H5N3O2/c5-3-1-2-4(6-3)7(8)9/h1-2,6H,5H2 |
| InChIKey | HMJZRTMDFLWDEN-UHFFFAOYSA-N |
| Density | 1.552g/cm3 (Cal.) |
|---|---|
| Boiling point | 410.533°C at 760 mmHg (Cal.) |
| Flash point | 202.084°C (Cal.) |
| Refractive index | 1.695 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Nitro-1H-Pyrrol-2-Amine |