|
CAS#: 19282-52-1 Product: 2,3,5,6-Pentafluoro-alpha-(Nitromethyl)Benzyl Alcohol No suppilers available for the product. |
| Name | 2,3,5,6-Pentafluoro-alpha-(Nitromethyl)Benzyl Alcohol |
|---|---|
| Synonyms | Nsc115746 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H4F5NO3 |
| Molecular Weight | 257.12 |
| CAS Registry Number | 19282-52-1 |
| SMILES | C(C(O)C1=C(F)C(=C(C(=C1F)F)F)F)[N+](=O)[O-] |
| InChI | 1S/C8H4F5NO3/c9-4-3(2(15)1-14(16)17)5(10)7(12)8(13)6(4)11/h2,15H,1H2 |
| InChIKey | JATSBNOGFCYNOT-UHFFFAOYSA-N |
| Density | 1.666g/cm3 (Cal.) |
|---|---|
| Boiling point | 278.311°C at 760 mmHg (Cal.) |
| Flash point | 122.119°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,5,6-Pentafluoro-alpha-(Nitromethyl)Benzyl Alcohol |