Online Database of Chemicals from Around the World
|
CAS#: 19284-13-0 Product: alpha-Allyloxyhydratropamide No suppilers available for the product. |
| Name | alpha-Allyloxyhydratropamide |
|---|---|
| Synonyms | 2-Allyloxy-2-Phenyl-Propanamide; 2-Allyloxy-2-Phenylpropanamide; 2-Allyloxy-2-Phenyl-Propionamide |
| Molecular Structure |  |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 |
| CAS Registry Number | 19284-13-0 |
| EINECS | 242-938-5 |
| SMILES | C1=C(C(C(=O)N)(OCC=C)C)C=CC=C1 |
| InChI | 1S/C12H15NO2/c1-3-9-15-12(2,11(13)14)10-7-5-4-6-8-10/h3-8H,1,9H2,2H3,(H2,13,14) |
| InChIKey | SEQVAKULKNLKNI-UHFFFAOYSA-N |
| Density | 1.072g/cm3 (Cal.) |
|---|---|
| Boiling point | 339.837°C at 760 mmHg (Cal.) |
| Flash point | 151.616°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha-Allyloxyhydratropamide |