| Pony Biomedical Technology (shanghai) Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.ponymed.com | |||
![]() | +86 15000678663 | |||
![]() | kangheng@ponytest.com | |||
![]() | QQ Chat | |||
| Chemical manufacturer since 2020 | ||||
| chemBlink Standard supplier since 2023 | ||||
| Name | (1-hydroxycyclopentyl)phenyl-Methanone |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 |
| CAS Registry Number | 19300-92-6 |
| SMILES | C1CCC(C1)(C(=O)C2=CC=CC=C2)O |
| Solubility | 3430 mg/L (25 °C water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.588, Calc.* |
| Melting point | 85.05 °C |
| Boiling Point | 307.14 °C, 322.8±25.0 °C (760 mmHg), Calc.* |
| Flash Point | 137.0±15.8 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for (1-hydroxycyclopentyl)phenyl-Methanone |