Online Database of Chemicals from Around the World
|
CAS#: 19316-72-4 Product: Ethoxybornane No suppilers available for the product. |
| Name | Ethoxybornane |
|---|---|
| Synonyms | 2-Ethoxy-1,7,7-Trimethyl-Norbornane; 2-Ethoxy-1,7,7-Trimethylnorbornane; 6-Ethoxy-1,7,7-Trimethyl-Bicyclo[2.2.1]Heptane |
| Molecular Structure |  |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 |
| CAS Registry Number | 19316-72-4 |
| EINECS | 242-956-3 |
| SMILES | C(OC1C2(CCC(C1)C2(C)C)C)C |
| InChI | 1S/C12H22O/c1-5-13-10-8-9-6-7-12(10,4)11(9,2)3/h9-10H,5-8H2,1-4H3 |
| InChIKey | FTRQTUIGTQZQBL-UHFFFAOYSA-N |
| Density | 0.922g/cm3 (Cal.) |
|---|---|
| Boiling point | 205.938°C at 760 mmHg (Cal.) |
| Flash point | 70.604°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethoxybornane |