|
CAS#: 19372-21-5 Product: Copper(2+) Dihydrogen Diphosphate No suppilers available for the product. |
| Name | Copper(2+) Dihydrogen Diphosphate |
|---|---|
| Synonyms | diphosphoric acid, copper salt; diphosphoric acid, copper(2+) salt; PYROPHOSPHORIC ACID, COPPER SALT |
| Molecular Structure | ![]() |
| Molecular Formula | H2CuO7P2 |
| Molecular Weight | 239.51 |
| CAS Registry Number | 19372-21-5 |
| EINECS | 243-000-8 |
| SMILES | [Cu+2].[O-]P(O)(=O)OP([O-])(O)=O |
| InChI | 1S/Cu.H4O7P2/c;1-8(2,3)7-9(4,5)6/h;(H2,1,2,3)(H2,4,5,6)/q+2;/p-2 |
| InChIKey | LCSAYGBGVLEKPO-UHFFFAOYSA-L |
| Refractive index | (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Copper(2+) Dihydrogen Diphosphate |