|
CAS#: 1945-53-5 Product: Palustric acid No suppilers available for the product. |
| Name | Palustric acid |
|---|---|
| Synonyms | 7-Isopropyl-1,4A-Dimethyl-2,3,4,5,6,9,10,10A-Octahydrophenanthrene-1-Carboxylic Acid; 8,13-Abietadien-18-Oic Acid; Palustric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 |
| CAS Registry Number | 1945-53-5 |
| SMILES | CC23C1=C(C=C(CC1)C(C)C)CCC2C(C(=O)O)(C)CCC3 |
| InChI | 1S/C20H30O2/c1-13(2)14-6-8-16-15(12-14)7-9-17-19(16,3)10-5-11-20(17,4)18(21)22/h12-13,17H,5-11H2,1-4H3,(H,21,22) |
| InChIKey | MLBYBBUZURKHAW-UHFFFAOYSA-N |
| Density | 1.066g/cm3 (Cal.) |
|---|---|
| Boiling point | 440.242°C at 760 mmHg (Cal.) |
| Flash point | 208.402°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Palustric acid |