Online Database of Chemicals from Around the World
|
CAS#: 1949-44-6 Product: 3,5-Bis[Acetyl(Methyl)Amino]-2,4,6-Triiodobenzoic Acid No suppilers available for the product. |
| Name | 3,5-Bis[Acetyl(Methyl)Amino]-2,4,6-Triiodobenzoic Acid |
|---|---|
| Molecular Structure | ![CAS#: 1949-44-6， 3,5-Bis[Acetyl(Methyl)Amino]-2,4,6-Triiodobenzoic Acid](/moreStructures/1949-44-6.gif) |
| Molecular Formula | C13H13I3N2O4 |
| Molecular Weight | 641.97 |
| CAS Registry Number | 1949-44-6 |
| SMILES | Ic1c(c(I)c(c(I)c1N(C(=O)C)C)C(=O)O)N(C(=O)C)C |
| InChI | 1S/C13H13I3N2O4/c1-5(19)17(3)11-8(14)7(13(21)22)9(15)12(10(11)16)18(4)6(2)20/h1-4H3,(H,21,22) |
| InChIKey | HXLHPWRFRAZDQW-UHFFFAOYSA-N |
| Density | 2.365g/cm3 (Cal.) |
|---|---|
| Boiling point | 659.494°C at 760 mmHg (Cal.) |
| Flash point | 352.649°C (Cal.) |
| Refractive index | 1.744 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5-Bis[Acetyl(Methyl)Amino]-2,4,6-Triiodobenzoic Acid |