| Hexagon Labs | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (609) 977-2723 | |||
![]() |
sales@hexagonlabs.com | |||
| Chemical manufacturer since 2005 | ||||
| Tyger Scientific Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (609) 434-0144 | |||
![]() |
sales@tygersci.com | |||
| Chemical manufacturer since 1992 | ||||
| Name | (5aS,7S)-7-Isopropenyl-3-methyl-6,7,8,9-tetrahydro-1H,5aH-pyrano[4,3-b]chromen-1-one |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.31 |
| CAS Registry Number | 194937-75-2 |
| SMILES | O=C2O/C(=C\C=1O[C@@H]3/C(=C\C=12)CC[C@H](\C(=C)C)C3)C |
| InChI | 1S/C16H18O3/c1-9(2)11-4-5-12-7-13-15(19-14(12)8-11)6-10(3)18-16(13)17/h6-7,11,14H,1,4-5,8H2,2-3H3/t11-,14-/m0/s1 |
| InChIKey | GRYISIULMJKOLF-FZMZJTMJSA-N |
| Density | 1.168g/cm3 (Cal.) |
|---|---|
| Boiling point | 429.197°C at 760 mmHg (Cal.) |
| Flash point | 182.927°C (Cal.) |
| Refractive index | 1.564 (Cal.) |
| (1) | D. H. Hua, Y. Chen, P. D. Robinson and C. Y. Meyers. (5aS,7S)-7-Isopropenyl-3-methyl-5a,6,8,9-tetrahydro-1H,7H-pyrano[4,3-b][1]benzopyran-1-one, Acta Cryst. (1997). C53, 1995-1997 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (5aS,7S)-7-Isopropenyl-3-methyl-6,7,8,9-tetrahydro-1H,5aH-pyrano[4,3-b]chromen-1-one |