Online Database of Chemicals from Around the World
|
CAS#: 19495-02-4 Product: 4-Bromo-4'-Isothiocyanatomethyl-1,1'-Biphenyl No suppilers available for the product. |
| Name | 4-Bromo-4'-Isothiocyanatomethyl-1,1'-Biphenyl |
|---|---|
| Synonyms | 1,1'-Biphenyl, 4-Bromo-4'-Isothiocyanatomethyl-; 4-Bromo-4'-Biphenylmethylisothiocyanate |
| Molecular Structure |  |
| Molecular Formula | C14H10BrNS |
| Molecular Weight | 304.20 |
| CAS Registry Number | 19495-02-4 |
| SMILES | S=C=NCC2=CC=C(C1=CC=C(Br)C=C1)C=C2 |
| InChI | 1S/C14H10BrNS/c15-14-7-5-13(6-8-14)12-3-1-11(2-4-12)9-16-10-17/h1-8H,9H2 |
| InChIKey | XPBFXCGRVDYVDO-UHFFFAOYSA-N |
| Density | 1.341g/cm3 (Cal.) |
|---|---|
| Boiling point | 420.171°C at 760 mmHg (Cal.) |
| Flash point | 207.912°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Bromo-4'-Isothiocyanatomethyl-1,1'-Biphenyl |