Online Database of Chemicals from Around the World
|
CAS#: 19559-24-1 Product: Xanthocillin X Monomethyl Ether No suppilers available for the product. |
| Name | Xanthocillin X Monomethyl Ether |
|---|---|
| Synonyms | Brn 4332417; Ethylene Isocyanide, (P-Hydroxybenzylidene)(P-Methoxybenzylidine)-; Phenol, 4-(2,3-Diisocyano-4-(4-Methoxyphenyl)-1,3-Butadienyl)- (9Ci) |
| Molecular Structure |  |
| Molecular Formula | C19H14N2O2 |
| Molecular Weight | 302.33 |
| CAS Registry Number | 19559-24-1 |
| SMILES | C2=C(/C=C([N+]#[C-])/C([N+]#[C-])=C/C1=CC=C(O)C=C1)C=CC(=C2)OC |
| InChI | 1S/C19H14N2O2/c1-20-18(12-14-4-8-16(22)9-5-14)19(21-2)13-15-6-10-17(23-3)11-7-15/h4-13,22H,3H3/b18-12-,19-13- |
| InChIKey | NIFGBMKUAMIQJA-BKHHGCLFSA-N |
| Market Analysis Reports |
| List of Reports Available for Xanthocillin X Monomethyl Ether |