Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 2,4-Dibromoestradiol |
|---|---|
| Synonyms | Estra-1,3,5(10)-Triene-3,17.Beta.-Diol, 2,4-Dibromo-; Nsc103054; Nci60_000083 |
| Molecular Structure |  |
| Molecular Formula | C18H22Br2O2 |
| Molecular Weight | 430.18 |
| CAS Registry Number | 19590-55-7 |
| SMILES | C1=C(Br)C(=C(C4=C1C3C(C2C(C(O)CC2)(C)CC3)CC4)Br)O |
| InChI | 1S/C18H22Br2O2/c1-18-7-6-9-10(13(18)4-5-15(18)21)2-3-11-12(9)8-14(19)17(22)16(11)20/h8-10,13,15,21-22H,2-7H2,1H3 |
| InChIKey | UTXNYGUZJLLOSP-UHFFFAOYSA-N |
| Density | 1.623g/cm3 (Cal.) |
|---|---|
| Boiling point | 454.793°C at 760 mmHg (Cal.) |
| Flash point | 228.851°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Dibromoestradiol |