Online Database of Chemicals from Around the World
|
CAS#: 196-52-1 Product: Dibenzo(c,p)Chrysene No suppilers available for the product. |
| Name | Dibenzo(c,p)Chrysene |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C26H16 |
| Molecular Weight | 328.41 |
| CAS Registry Number | 196-52-1 |
| SMILES | C4=C3C1=C6C(=CC=C1C2=CC=CC=C2C3=C5C(=C4)C=CC=C5)C=CC=C6 |
| InChI | 1S/C26H16/c1-4-10-20-17(7-1)13-15-23-21-11-5-6-12-22(21)25-19-9-3-2-8-18(19)14-16-24(25)26(20)23/h1-16H |
| InChIKey | RJXPMUHZQGSTIM-UHFFFAOYSA-N |
| Density | 1.263g/cm3 (Cal.) |
|---|---|
| Boiling point | 604.127°C at 760 mmHg (Cal.) |
| Flash point | 314.612°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dibenzo(c,p)Chrysene |