| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Endotherm GmbH | Germany | Inquire | ||
|---|---|---|---|---|
![]() |
+49 (681) 3946-7570 | |||
![]() |
info@endotherm.de | |||
| Chemical manufacturer | ||||
| Name | 2,2'-Dithiodibenzoyl Chloride |
|---|---|
| Synonyms | 2-(2-Chlorocarbonylphenyl)Disulfanylbenzoyl Chloride; 2,2'-Dithiodibenzoyl Chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C14H8Cl2O2S2 |
| Molecular Weight | 343.24 |
| CAS Registry Number | 19602-82-5 |
| EINECS | 243-180-8 |
| SMILES | C1=C(C(=CC=C1)C(=O)Cl)SSC2=C(C=CC=C2)C(=O)Cl |
| InChI | 1S/C14H8Cl2O2S2/c15-13(17)9-5-1-3-7-11(9)19-20-12-8-4-2-6-10(12)14(16)18/h1-8H |
| InChIKey | DSFZYLCRXIWFFW-UHFFFAOYSA-N |
| Density | 1.51g/cm3 (Cal.) |
|---|---|
| Boiling point | 443.711°C at 760 mmHg (Cal.) |
| Flash point | 222.149°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Pushparathinam Gopinath, Surapaneni Nilaya, Tripathy Ranjan Debi, Venkatachalam Ramkumar and Kannoth Manheri Muraleedharan. As many as six tandem reactions in one step! Unprecedented formation of highly functionalized benzothiophenes, Chem. Commun., 2009, , 7131. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,2'-Dithiodibenzoyl Chloride |