| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (3aR,6aS)-5-Acetyl-3,3A,6,6A-Tetrahydro-2H-Cyclopenta[b]Furan-2-One |
|---|---|
| Synonyms | InChI=1/C |
| Molecular Structure | ![]() |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.17 |
| CAS Registry Number | 196297-98-0 |
| SMILES | CC(=O)C1=C[C@H]2CC(=O)O[C@H]2C1 |
| InChI | 1S/C9H10O3/c1-5(10)6-2-7-4-9(11)12-8(7)3-6/h2,7-8H,3-4H2,1H3/t7-,8-/m0/s1 |
| InChIKey | PHLGONRXWTVAFS-YUMQZZPRSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 364.8±42.0°C at 760 mmHg (Cal.) |
| Flash point | 166.9±27.9°C (Cal.) |
| Refractive index | 1.527 (Cal.) |
| (1) | Chunjian Liu, Guanglin Bao and D. Jean Burnell. Synthetic studies toward the kempane diterpenes. Diels–Alder additions to bicyclic dienes, J. Chem. Soc., Perkin Trans. 1, 2001, 0, 2644. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (3aR,6aS)-5-Acetyl-3,3A,6,6A-Tetrahydro-2H-Cyclopenta[b]Furan-2-One |