Online Database of Chemicals from Around the World
|
CAS#: 19672-12-9 Product: 5-Ethyl-4,7-Dimethoxy-2,3-Dimethylbenzofuran No suppilers available for the product. |
| Name | 5-Ethyl-4,7-Dimethoxy-2,3-Dimethylbenzofuran |
|---|---|
| Synonyms | 5-Ethyl-4,7-Dimethoxy-2,3-Dimethyl-Benzofuran; 5-Ethyl-4,7-Dimethoxy-2,3-Dimethylbenzofuran; 4,7-Dimethoxy-2,3-Dimethyl-5-Ethylbenzofuran |
| Molecular Structure |  |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 |
| CAS Registry Number | 19672-12-9 |
| SMILES | C1=C(C2=C(C(=C1CC)OC)C(=C(O2)C)C)OC |
| InChI | 1S/C14H18O3/c1-6-10-7-11(15-4)14-12(13(10)16-5)8(2)9(3)17-14/h7H,6H2,1-5H3 |
| InChIKey | LDSJJYXJWVKEGX-UHFFFAOYSA-N |
| Density | 1.066g/cm3 (Cal.) |
|---|---|
| Boiling point | 346.959°C at 760 mmHg (Cal.) |
| Flash point | 180.261°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Ethyl-4,7-Dimethoxy-2,3-Dimethylbenzofuran |