|
CAS#: 19717-59-0 Product: 3-(Acetylamino)-2-Naphthoic Acid No suppilers available for the product. |
| Name | 3-(Acetylamino)-2-Naphthoic Acid |
|---|---|
| Synonyms | 3-Acetamido-2-Naphthalenecarboxylate; 3-Acetamido-2-Naphthoate; Zinc04218992 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10NO3 |
| Molecular Weight | 228.23 |
| CAS Registry Number | 19717-59-0 |
| SMILES | C2=C1C=CC=CC1=CC(=C2NC(C)=O)C([O-])=O |
| InChI | 1S/C13H11NO3/c1-8(15)14-12-7-10-5-3-2-4-9(10)6-11(12)13(16)17/h2-7H,1H3,(H,14,15)(H,16,17)/p-1 |
| InChIKey | FHXRDNPWHSTOGC-UHFFFAOYSA-M |
| Boiling point | 482.181°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 245.414°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-(Acetylamino)-2-Naphthoic Acid |