Online Database of Chemicals from Around the World
|
CAS#: 19765-06-1 Product: 1-[2-(2-Iodoethoxy)Ethyl]-2-Methyl-4-Nitro-Imidazole No suppilers available for the product. |
| Name | 1-[2-(2-Iodoethoxy)Ethyl]-2-Methyl-4-Nitro-Imidazole |
|---|---|
| Synonyms | 1-[2-(2-Iodoethoxy)Ethyl]-2-Methyl-4-Nitro-Imidazole; 1-((2-Iodoethoxy)Ethyl)-2-Methyl-4-Nitroimidazole; Brn 0527003 |
| Molecular Structure | ![CAS#: 19765-06-1， 1-[2-(2-Iodoethoxy)Ethyl]-2-Methyl-4-Nitro-Imidazole](/moreStructures/19765-06-1.gif) |
| Molecular Formula | C8H12IN3O3 |
| Molecular Weight | 325.11 |
| CAS Registry Number | 19765-06-1 |
| SMILES | C1=C(N=C([N]1CCOCCI)C)[N+]([O-])=O |
| InChI | 1S/C8H12IN3O3/c1-7-10-8(12(13)14)6-11(7)3-5-15-4-2-9/h6H,2-5H2,1H3 |
| InChIKey | IGUWYUDXYJAZMX-UHFFFAOYSA-N |
| Density | 1.837g/cm3 (Cal.) |
|---|---|
| Boiling point | 436.472°C at 760 mmHg (Cal.) |
| Flash point | 217.771°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[2-(2-Iodoethoxy)Ethyl]-2-Methyl-4-Nitro-Imidazole |