Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2,2-Difluoro-1-(2-Nitrophenyl)Ethanol |
|---|---|
| Synonyms | 2,2-difluoro-1-(2-nitrophenyl)ethanol; BENZENEMETHANOL, A-(DIFLUOROMETHYL)-2-NITRO- |
| Molecular Structure |  |
| Molecular Formula | C8H7F2NO3 |
| Molecular Weight | 203.14 |
| CAS Registry Number | 197783-86-1 |
| SMILES | c1ccc(c(c1)C(C(F)F)O)[N+](=O)[O-] |
| InChI | 1S/C8H7F2NO3/c9-8(10)7(12)5-3-1-2-4-6(5)11(13)14/h1-4,7-8,12H |
| InChIKey | DNGHTKXRXKQDHV-UHFFFAOYSA-N |
| Density | 1.414g/cm3 (Cal.) |
|---|---|
| Boiling point | 354.452°C at 760 mmHg (Cal.) |
| Flash point | 168.167°C (Cal.) |
| Refractive index | 1.527 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Difluoro-1-(2-Nitrophenyl)Ethanol |