Online Database of Chemicals from Around the World
| Name | 1-Cyano-2-Ethoxy-2-Oxoethyl Benzoate |
|---|---|
| Synonyms | 1-Cyano-2-ethoxy-2-oxoethyl benzoate #; Acetic acid, 2-(benzoyloxy)-2-cyano-, ethyl ester |
| Molecular Structure |  |
| Molecular Formula | C12H11NO4 |
| Molecular Weight | 233.22 |
| CAS Registry Number | 19788-59-1 |
| SMILES | O=C(OC(C#N)C(=O)OCC)c1ccccc1 |
| InChI | 1S/C12H11NO4/c1-2-16-12(15)10(8-13)17-11(14)9-6-4-3-5-7-9/h3-7,10H,2H2,1H3 |
| InChIKey | PMUPRIZMXFGFCO-UHFFFAOYSA-N |
| Density | 1.224g/cm3 (Cal.) |
|---|---|
| Boiling point | 418.693°C at 760 mmHg (Cal.) |
| Flash point | 183.036°C (Cal.) |
| Refractive index | 1.523 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Cyano-2-Ethoxy-2-Oxoethyl Benzoate |
