| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() | www.purerechem.com | |||
![]() | +86 (551) 6288-8437 +86 18096409024 | |||
![]() | info@purerechem.com | |||
![]() | QQ Chat | |||
![]() | Skype Chat | |||
![]() | WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Toladryl |
|---|---|
| Synonyms | N,N-dimethyl-2-[(4-methylphenyl)-phenylmethoxy]ethanamine |
| Molecular Structure | ![]() |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.38 |
| CAS Registry Number | 19804-27-4 |
| EC Number | 243-329-7 |
| SMILES | CC1=CC=C(C=C1)C(C2=CC=CC=C2)OCCN(C)C |
| Solubility | 142.2 mg/L (25 °C water) |
|---|---|
| Density | 1.0±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.549, Calc.* |
| Melting point | 109.54 °C |
| Boiling Point | 356.60 °C, 362.5±32.0 °C (760 mmHg), Calc.* |
| Flash Point | 107.0±27.4 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302 Details |
| Safety Statements | P264-P301+P312 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Toladryl |