Online Database of Chemicals from Around the World
|
CAS#: 19832-27-0 Product: 3-(1,3-Dimethyl-3-Azetidinyl)Phenol No suppilers available for the product. |
| Name | 3-(1,3-Dimethyl-3-Azetidinyl)Phenol |
|---|---|
| Synonyms | 1,3-Dimethyl-3-(M-Hydroxyphenyl)Azetidine; 3-(1,3-Dimethyl-3-Azetidinyl)Phenol; Azetidine, 1,3-Dimethyl-3-(M-Hydroxyphenyl)- |
| Molecular Structure |  |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 |
| CAS Registry Number | 19832-27-0 |
| SMILES | C1=C(C=CC=C1O)C2(CN(C2)C)C |
| InChI | 1S/C11H15NO/c1-11(7-12(2)8-11)9-4-3-5-10(13)6-9/h3-6,13H,7-8H2,1-2H3 |
| InChIKey | KEYPQTMTBMALPJ-UHFFFAOYSA-N |
| Density | 1.087g/cm3 (Cal.) |
|---|---|
| Boiling point | 289.615°C at 760 mmHg (Cal.) |
| Flash point | 138.76°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(1,3-Dimethyl-3-Azetidinyl)Phenol |