| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Serine derivative |
|---|---|
| Name | N2-[(9H-Fluoren-9-Ylmethoxy)Carbonyl]-N6-{[2-(Trimethylsilyl)Ethoxy]Carbonyl}-D-Lysine |
| Synonyms | D-Lysine, N2-[(9H-fluoren-9-ylmethoxy)carbonyl]-N6-[[2-(tri |
| Molecular Structure | ![]() |
| Molecular Formula | C27H36N2O6Si |
| Molecular Weight | 512.67 |
| CAS Registry Number | 198545-00-5 |
| SMILES | C[Si](C)(C)CCOC(=O)NCCCC[C@H](C(=O)O)NC(=O)OCC1c2ccccc2-c3c1cccc3 |
| InChI | 1S/C27H36N2O6Si/c1-36(2,3)17-16-34-26(32)28-15-9-8-14-24(25(30)31)29-27(33)35-18-23-21-12-6-4-10-19(21)20-11-5-7-13-22(20)23/h4-7,10-13,23-24H,8-9,14-18H2,1-3H3,(H,28,32)(H,29,33)(H,30,31)/t24-/m1/s1 |
| InChIKey | OPNHWQULKLODEU-XMMPIXPASA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 695.7±55.0°C at 760 mmHg (Cal.) |
| Flash point | 374.5±31.5°C (Cal.) |
| Refractive index | 1.549 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N2-[(9H-Fluoren-9-Ylmethoxy)Carbonyl]-N6-{[2-(Trimethylsilyl)Ethoxy]Carbonyl}-D-Lysine |