Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Fluorobenzyl (2,5-Difluorophenyl)Carbamate |
|---|---|
| Synonyms | (2-fluorophenyl)methyl N-(2,5-difluorophenyl)carbamate; 2-fluorobenzyl (2,5-difluorophenyl)carbamate |
| Molecular Structure |  |
| Molecular Formula | C14H10F3NO2 |
| Molecular Weight | 281.23 |
| CAS Registry Number | 198879-58-2 |
| SMILES | O=C(OCc1ccccc1F)Nc2cc(F)ccc2F |
| InChI | 1S/C14H10F3NO2/c15-10-5-6-12(17)13(7-10)18-14(19)20-8-9-3-1-2-4-11(9)16/h1-7H,8H2,(H,18,19) |
| InChIKey | NOIIZKLGKVNXEO-UHFFFAOYSA-N |
| Density | 1.391g/cm3 (Cal.) |
|---|---|
| Boiling point | 313.97°C at 760 mmHg (Cal.) |
| Flash point | 143.684°C (Cal.) |
| Refractive index | 1.574 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Fluorobenzyl (2,5-Difluorophenyl)Carbamate |