Online Database of Chemicals from Around the World
|
CAS#: 19962-41-5 Product: (2,6-Dimethylphenyl)(Trimethyl)Stannane No suppilers available for the product. |
| Name | (2,6-Dimethylphenyl)(Trimethyl)Stannane |
|---|---|
| Synonyms | (2,6-Dimethylphenyl)(trimethyl)stannane #; 2,6-Dimethylphenyltrimethyltin; Trimethyl(2,6-dimethylphenyl)tin |
| Molecular Structure |  |
| Molecular Formula | C11H18Sn |
| Molecular Weight | 268.97 |
| CAS Registry Number | 19962-41-5 |
| SMILES | c1(c(cccc1C)C)[Sn](C)(C)C |
| InChI | 1S/C8H9.3CH3.Sn/c1-7-4-3-5-8(2)6-7;;;;/h3-5H,1-2H3;3*1H3; |
| InChIKey | BDTDBGWGERDDGJ-UHFFFAOYSA-N |
| Boiling point | 252.827°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 108.48°C (Cal.) |
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2,6-Dimethylphenyl)(Trimethyl)Stannane |