| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Asparagine derivatives |
|---|---|
| Name | DL-Alanyl-DL-Asparagine |
| Synonyms | 4-Amino-2-(2-Aminopropanoylamino)-4-Oxo-Butanoic Acid; 4-Amino-2-[(2-Amino-1-Oxopropyl)Amino]-4-Oxobutanoic Acid; 2-(Alanylamino)-4-Amino-4-Keto-Butyric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C7H13N3O4 |
| Molecular Weight | 203.20 |
| CAS Registry Number | 1999-41-3 |
| SMILES | C(C(NC(C(C)N)=O)C(O)=O)C(N)=O |
| InChI | 1S/C7H13N3O4/c1-3(8)6(12)10-4(7(13)14)2-5(9)11/h3-4H,2,8H2,1H3,(H2,9,11)(H,10,12)(H,13,14) |
| InChIKey | CCUAQNUWXLYFRA-UHFFFAOYSA-N |
| Density | 1.356g/cm3 (Cal.) |
|---|---|
| Boiling point | 595.616°C at 760 mmHg (Cal.) |
| Flash point | 314.017°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for DL-Alanyl-DL-Asparagine |