Online Database of Chemicals from Around the World
| Name | 9-Chloro-10-Chloromethylanthracene |
|---|---|
| Synonyms | 10-(Chloromethyl)-9-Chloroanthracene; 10-Chloromethyl-9-Chloroanthracene; 9-Chloro-10-Chloromethylanthracene |
| Molecular Structure |  |
| Molecular Formula | C15H10Cl2 |
| Molecular Weight | 261.15 |
| CAS Registry Number | 19996-03-3 |
| SMILES | C1=CC=CC2=C1C(=C3C(=C2Cl)C=CC=C3)CCl |
| InChI | 1S/C15H10Cl2/c16-9-14-10-5-1-3-7-12(10)15(17)13-8-4-2-6-11(13)14/h1-8H,9H2 |
| InChIKey | XPUGCURTNYKMLB-UHFFFAOYSA-N |
| Density | 1.324g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.818°C at 760 mmHg (Cal.) |
| Flash point | 222.615°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-Chloro-10-Chloromethylanthracene |
