|
CAS#: 20018-12-6 Product: Diiodo Methyl 4-Chlorophenyl Sulfone No suppilers available for the product. |
| Name | Diiodo Methyl 4-Chlorophenyl Sulfone |
|---|---|
| Synonyms | Epa Pesticide Chemical Code 101001; Sulfone, P-Chlorophenyl Diiodomethyl; P-Chlorophenyl Diiodomethyl Sulfone |
| Molecular Structure | ![]() |
| Molecular Formula | C7H5ClI2O2S |
| Molecular Weight | 442.44 |
| CAS Registry Number | 20018-12-6 |
| SMILES | C1=C(Cl)C=CC(=C1)[S](=O)(=O)C(I)I |
| InChI | 1S/C7H5ClI2O2S/c8-5-1-3-6(4-2-5)13(11,12)7(9)10/h1-4,7H |
| InChIKey | GASOXIRLBJILKE-UHFFFAOYSA-N |
| Density | 2.442g/cm3 (Cal.) |
|---|---|
| Boiling point | 435.74°C at 760 mmHg (Cal.) |
| Flash point | 217.328°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diiodo Methyl 4-Chlorophenyl Sulfone |