Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Caffeidine |
|---|---|
| Synonyms | N,3-Dimethyl-5-Methylamino-Imidazole-4-Carboxamide; N,3-Dimethyl-5-Methylamino-4-Imidazolecarboxamide; Caffeidine |
| Molecular Structure |  |
| Molecular Formula | C7H12N4O |
| Molecular Weight | 168.20 |
| CAS Registry Number | 20041-90-1 |
| SMILES | C1=NC(=C(C(NC)=O)[N]1C)NC |
| InChI | 1S/C7H12N4O/c1-8-6-5(7(12)9-2)11(3)4-10-6/h4,8H,1-3H3,(H,9,12) |
| InChIKey | FNYXJOYPHLKLRW-UHFFFAOYSA-N |
| Density | 1.234g/cm3 (Cal.) |
|---|---|
| Boiling point | 452.034°C at 760 mmHg (Cal.) |
| Flash point | 227.182°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Caffeidine |