| Guangzhou Topwork Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.topworkchem.com | |||
![]() | +86 (20) 8731-7062 +86 13544492387 | |||
![]() | +86 (20) 8731-7061 | |||
![]() | sales@topworkchem.com topwork2004@hotmail.com | |||
![]() | QQ Chat | |||
![]() | Skype Chat | |||
![]() | WeChat: 13544492387 | |||
![]() | WhatsApp:13544492387 | |||
| Chemical manufacturer since 2004 | ||||
| chemBlink Standard supplier since 2006 | ||||
| Name | Trilostane Impurity 5 |
|---|---|
| Synonyms | 4alpha,5-Epoxy-5alpha-androst-2-eno(2,3-d)isoxazol-17beta-ol |
| Molecular Structure | ![]() |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.43 |
| CAS Registry Number | 20051-76-7 |
| EC Number | 243-485-6 |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O)CC[C@]45[C@@]3(CC6=C([C@H]4O5)ON=C6)C |
| Solubility | 45.9 mg/L (25 °C water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.608, Calc.* |
| Melting point | 168.67 °C |
| Boiling Point | 405.96 °C, 490.1±45.0 °C (760 mmHg), Calc.* |
| Flash Point | 250.2±28.7 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H315-H319-H361 Details | ||||||||||||||||
| Safety Statements | P203-P264-P264+P265-P280-P302+P352-P305+P351+P338-P318-P321-P332+P317-P337+P317-P362+P364-P405-P501 Details | ||||||||||||||||
| Hazard Classification | |||||||||||||||||
| |||||||||||||||||
| SDS | Available | ||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for Trilostane Impurity 5 |