Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Dihydrogriesenin |
|---|---|
| Synonyms | C09396 |
| Molecular Structure |  |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 |
| CAS Registry Number | 20087-05-2 |
| SMILES | [C@@]234C[C@H]1OC(C([C@H]1CC=C2CC[C@@](O3)(C)OC4)=C)=O |
| InChI | 1S/C15H18O4/c1-9-11-4-3-10-5-6-14(2)17-8-15(10,19-14)7-12(11)18-13(9)16/h3,11-12H,1,4-8H2,2H3/t11-,12-,14+,15+/m1/s1 |
| InChIKey | QOWDVJAIJZLWBJ-UXOAXIEHSA-N |
| Density | 1.268g/cm3 (Cal.) |
|---|---|
| Boiling point | 451.759°C at 760 mmHg (Cal.) |
| Flash point | 203.329°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dihydrogriesenin |