| Hoffman Fine Chemicals Pty Ltd | Australia | Inquire | ||
|---|---|---|---|---|
![]() | www.hoffmanchemicals.com | |||
![]() | +61 3-7003-5401 | |||
![]() | info@hoffmanchemicals.com | |||
| Chemical manufacturer | ||||
| chemBlink Standard supplier since 2023 | ||||
| Name | 4-Bromo-1,2-bis(hexyloxy)benzene |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C18H29BrO2 |
| Molecular Weight | 357.33 |
| CAS Registry Number | 200959-51-9 |
| SMILES | CCCCCCOC1=C(C=C(C=C1)Br)OCCCCCC |
| Density | 1.1±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.499, Calc.* |
| Boiling Point | 396.9±22.0 °C (760 mmHg), Calc.* |
| Flash Point | 138.9±17.8 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 4-Bromo-1,2-bis(hexyloxy)benzene |