Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | (4S)-4-(Bromomethyl)-2-Phenyl-1,3-Dioxane |
|---|---|
| Synonyms | Zinc02581375; St5405688 |
| Molecular Structure |  |
| Molecular Formula | C11H13BrO2 |
| Molecular Weight | 257.13 |
| CAS Registry Number | 201743-52-4 |
| SMILES | [C@@H]1(OCC[C@H](O1)CBr)C2=CC=CC=C2 |
| InChI | 1S/C11H13BrO2/c12-8-10-6-7-13-11(14-10)9-4-2-1-3-5-9/h1-5,10-11H,6-8H2/t10-,11-/m0/s1 |
| InChIKey | LZPOSTLTDVMAGB-QWRGUYRKSA-N |
| Density | 1.375g/cm3 (Cal.) |
|---|---|
| Boiling point | 335.908°C at 760 mmHg (Cal.) |
| Flash point | 143.023°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (4S)-4-(Bromomethyl)-2-Phenyl-1,3-Dioxane |